1-[(2,5-dimethylphenyl)methyl]-4-[3-(3-propyl-1,2,4-oxadiazol-5-yl)pyridin-2-yl]-1,4-diazepane
Chemical Structure Depiction of
1-[(2,5-dimethylphenyl)methyl]-4-[3-(3-propyl-1,2,4-oxadiazol-5-yl)pyridin-2-yl]-1,4-diazepane
1-[(2,5-dimethylphenyl)methyl]-4-[3-(3-propyl-1,2,4-oxadiazol-5-yl)pyridin-2-yl]-1,4-diazepane
Compound characteristics
| Compound ID: | P891-0235 |
| Compound Name: | 1-[(2,5-dimethylphenyl)methyl]-4-[3-(3-propyl-1,2,4-oxadiazol-5-yl)pyridin-2-yl]-1,4-diazepane |
| Molecular Weight: | 405.54 |
| Molecular Formula: | C24 H31 N5 O |
| Smiles: | CCCc1nc(c2cccnc2N2CCCN(CC2)Cc2cc(C)ccc2C)on1 |
| Stereo: | ACHIRAL |
| logP: | 5.3745 |
| logD: | 5.0825 |
| logSw: | -5.2644 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 49.211 |
| InChI Key: | FKERIOZISGXOMQ-UHFFFAOYSA-N |