N-cyclopentyl-4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phthalazin-1-amine
Chemical Structure Depiction of
N-cyclopentyl-4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phthalazin-1-amine
N-cyclopentyl-4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phthalazin-1-amine
Compound characteristics
| Compound ID: | P894-0048 |
| Compound Name: | N-cyclopentyl-4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phthalazin-1-amine |
| Molecular Weight: | 321.38 |
| Molecular Formula: | C18 H19 N5 O |
| Smiles: | C1CCC(C1)Nc1c2ccccc2c(c2nc(C3CC3)no2)nn1 |
| Stereo: | ACHIRAL |
| logP: | 3.8758 |
| logD: | 3.8747 |
| logSw: | -4.151 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.375 |
| InChI Key: | GTVNBOPGCCTVRS-UHFFFAOYSA-N |