1-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-4-(morpholin-4-yl)phthalazine
Chemical Structure Depiction of
1-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-4-(morpholin-4-yl)phthalazine
1-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-4-(morpholin-4-yl)phthalazine
Compound characteristics
| Compound ID: | P894-0176 |
| Compound Name: | 1-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-4-(morpholin-4-yl)phthalazine |
| Molecular Weight: | 373.41 |
| Molecular Formula: | C21 H19 N5 O2 |
| Smiles: | Cc1ccc(cc1)c1nc(c2c3ccccc3c(nn2)N2CCOCC2)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.293 |
| logD: | 4.2928 |
| logSw: | -4.2826 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 65.18 |
| InChI Key: | SKMHGDAEIOGQSC-UHFFFAOYSA-N |