N-(2-fluoro-5-methylphenyl)-1-oxo-2,3,4,5-tetrahydro-1H-pyrrolo[1,2-a][1,4]diazepine-8-sulfonamide
Chemical Structure Depiction of
N-(2-fluoro-5-methylphenyl)-1-oxo-2,3,4,5-tetrahydro-1H-pyrrolo[1,2-a][1,4]diazepine-8-sulfonamide
N-(2-fluoro-5-methylphenyl)-1-oxo-2,3,4,5-tetrahydro-1H-pyrrolo[1,2-a][1,4]diazepine-8-sulfonamide
Compound characteristics
| Compound ID: | P896-0129 |
| Compound Name: | N-(2-fluoro-5-methylphenyl)-1-oxo-2,3,4,5-tetrahydro-1H-pyrrolo[1,2-a][1,4]diazepine-8-sulfonamide |
| Molecular Weight: | 337.37 |
| Molecular Formula: | C15 H16 F N3 O3 S |
| Smiles: | Cc1ccc(c(c1)NS(c1cc2C(NCCCn2c1)=O)(=O)=O)F |
| Stereo: | ACHIRAL |
| logP: | 1.3872 |
| logD: | 1.3225 |
| logSw: | -2.5044 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.915 |
| InChI Key: | TZIXMODUJVKGFT-UHFFFAOYSA-N |