2-(2-chloro-6-fluorophenyl)-1-[rel-(3R,4R)-3-methyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethan-1-one
Chemical Structure Depiction of
2-(2-chloro-6-fluorophenyl)-1-[rel-(3R,4R)-3-methyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethan-1-one
2-(2-chloro-6-fluorophenyl)-1-[rel-(3R,4R)-3-methyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | P909-5695 |
| Compound Name: | 2-(2-chloro-6-fluorophenyl)-1-[rel-(3R,4R)-3-methyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethan-1-one |
| Molecular Weight: | 399.85 |
| Molecular Formula: | C21 H19 Cl F N3 O2 |
| Smiles: | C[C@H]1CN(C[C@@H]1c1nc(c2ccccc2)no1)C(Cc1c(cccc1[Cl])F)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 5.089 |
| logD: | 5.089 |
| logSw: | -5.4623 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.998 |
| InChI Key: | ZPAHNPHGUCPCQF-CZUORRHYSA-N |