1-(3-chloro-4-methylbenzene-1-sulfonyl)-4-(3-ethyl-4H-1,2,4-triazol-4-yl)piperidine
Chemical Structure Depiction of
1-(3-chloro-4-methylbenzene-1-sulfonyl)-4-(3-ethyl-4H-1,2,4-triazol-4-yl)piperidine
1-(3-chloro-4-methylbenzene-1-sulfonyl)-4-(3-ethyl-4H-1,2,4-triazol-4-yl)piperidine
Compound characteristics
| Compound ID: | P939-3743 |
| Compound Name: | 1-(3-chloro-4-methylbenzene-1-sulfonyl)-4-(3-ethyl-4H-1,2,4-triazol-4-yl)piperidine |
| Molecular Weight: | 368.88 |
| Molecular Formula: | C16 H21 Cl N4 O2 S |
| Smiles: | CCc1nncn1C1CCN(CC1)S(c1ccc(C)c(c1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1275 |
| logD: | 3.1274 |
| logSw: | -3.3521 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 57.382 |
| InChI Key: | LOMCGYOXYYTTFG-UHFFFAOYSA-N |