1-(5-chloro-2-methoxybenzene-1-sulfonyl)-4-[3-(methoxymethyl)-4H-1,2,4-triazol-4-yl]piperidine
Chemical Structure Depiction of
1-(5-chloro-2-methoxybenzene-1-sulfonyl)-4-[3-(methoxymethyl)-4H-1,2,4-triazol-4-yl]piperidine
1-(5-chloro-2-methoxybenzene-1-sulfonyl)-4-[3-(methoxymethyl)-4H-1,2,4-triazol-4-yl]piperidine
Compound characteristics
| Compound ID: | P939-5109 |
| Compound Name: | 1-(5-chloro-2-methoxybenzene-1-sulfonyl)-4-[3-(methoxymethyl)-4H-1,2,4-triazol-4-yl]piperidine |
| Molecular Weight: | 400.88 |
| Molecular Formula: | C16 H21 Cl N4 O4 S |
| Smiles: | COCc1nncn1C1CCN(CC1)S(c1cc(ccc1OC)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.4289 |
| logD: | 1.4288 |
| logSw: | -2.6177 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 73.436 |
| InChI Key: | NULNNGOKOFKGOH-UHFFFAOYSA-N |