3,5-dimethoxy-N-[(oxan-4-yl)methyl]benzamide
Chemical Structure Depiction of
3,5-dimethoxy-N-[(oxan-4-yl)methyl]benzamide
3,5-dimethoxy-N-[(oxan-4-yl)methyl]benzamide
Compound characteristics
| Compound ID: | P970-0115 |
| Compound Name: | 3,5-dimethoxy-N-[(oxan-4-yl)methyl]benzamide |
| Molecular Weight: | 279.33 |
| Molecular Formula: | C15 H21 N O4 |
| Smiles: | COc1cc(cc(c1)OC)C(NCC1CCOCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0902 |
| logD: | 2.0902 |
| logSw: | -2.4054 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.84 |
| InChI Key: | CHQGGQMNRRWTAE-UHFFFAOYSA-N |