2,5-dimethoxy-N-[(oxan-4-yl)methyl]benzene-1-sulfonamide
Chemical Structure Depiction of
2,5-dimethoxy-N-[(oxan-4-yl)methyl]benzene-1-sulfonamide
2,5-dimethoxy-N-[(oxan-4-yl)methyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | P970-0293 |
| Compound Name: | 2,5-dimethoxy-N-[(oxan-4-yl)methyl]benzene-1-sulfonamide |
| Molecular Weight: | 315.39 |
| Molecular Formula: | C14 H21 N O5 S |
| Smiles: | COc1ccc(c(c1)S(NCC1CCOCC1)(=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 1.9906 |
| logD: | 1.9905 |
| logSw: | -2.5716 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.272 |
| InChI Key: | ITZYUVGUNJYHET-UHFFFAOYSA-N |