4-chloro-1-ethyl-N-[(4-methyloxan-4-yl)methyl]-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
4-chloro-1-ethyl-N-[(4-methyloxan-4-yl)methyl]-1H-pyrazole-3-carboxamide
4-chloro-1-ethyl-N-[(4-methyloxan-4-yl)methyl]-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | P970-0509 |
| Compound Name: | 4-chloro-1-ethyl-N-[(4-methyloxan-4-yl)methyl]-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 285.77 |
| Molecular Formula: | C13 H20 Cl N3 O2 |
| Smiles: | CCn1cc(c(C(NCC2(C)CCOCC2)=O)n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 1.6171 |
| logD: | 1.6171 |
| logSw: | -2.552 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.801 |
| InChI Key: | WRKXLJNOMOLEMA-UHFFFAOYSA-N |