N-methyl-N-[(4-methyloxan-4-yl)methyl]-2-phenylacetamide
Chemical Structure Depiction of
N-methyl-N-[(4-methyloxan-4-yl)methyl]-2-phenylacetamide
N-methyl-N-[(4-methyloxan-4-yl)methyl]-2-phenylacetamide
Compound characteristics
| Compound ID: | P970-1161 |
| Compound Name: | N-methyl-N-[(4-methyloxan-4-yl)methyl]-2-phenylacetamide |
| Molecular Weight: | 261.36 |
| Molecular Formula: | C16 H23 N O2 |
| Smiles: | CC1(CCOCC1)CN(C)C(Cc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4434 |
| logD: | 2.4434 |
| logSw: | -2.4052 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.9622 |
| InChI Key: | HUHICDRALKWKBU-UHFFFAOYSA-N |