N-methyl-N-[(4-methyloxan-4-yl)methyl]-4-(trifluoromethyl)benzene-1-sulfonamide
Chemical Structure Depiction of
N-methyl-N-[(4-methyloxan-4-yl)methyl]-4-(trifluoromethyl)benzene-1-sulfonamide
N-methyl-N-[(4-methyloxan-4-yl)methyl]-4-(trifluoromethyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | P970-1305 |
| Compound Name: | N-methyl-N-[(4-methyloxan-4-yl)methyl]-4-(trifluoromethyl)benzene-1-sulfonamide |
| Molecular Weight: | 351.39 |
| Molecular Formula: | C15 H20 F3 N O3 S |
| Smiles: | CC1(CCOCC1)CN(C)S(c1ccc(cc1)C(F)(F)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2338 |
| logD: | 3.2338 |
| logSw: | -3.4546 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 40.903 |
| InChI Key: | VPELDSGZKMMYOK-UHFFFAOYSA-N |