3,5-difluoro-N-methyl-N-[(4-methyloxan-4-yl)methyl]benzene-1-sulfonamide
Chemical Structure Depiction of
3,5-difluoro-N-methyl-N-[(4-methyloxan-4-yl)methyl]benzene-1-sulfonamide
3,5-difluoro-N-methyl-N-[(4-methyloxan-4-yl)methyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | P970-1326 |
| Compound Name: | 3,5-difluoro-N-methyl-N-[(4-methyloxan-4-yl)methyl]benzene-1-sulfonamide |
| Molecular Weight: | 319.37 |
| Molecular Formula: | C14 H19 F2 N O3 S |
| Smiles: | CC1(CCOCC1)CN(C)S(c1cc(cc(c1)F)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.612 |
| logD: | 2.612 |
| logSw: | -2.5882 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 40.903 |
| InChI Key: | QGKDDOQYCWYXOV-UHFFFAOYSA-N |