4-fluoro-N-(2-methoxyethyl)-N-[(4-methyloxan-4-yl)methyl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-fluoro-N-(2-methoxyethyl)-N-[(4-methyloxan-4-yl)methyl]benzene-1-sulfonamide
4-fluoro-N-(2-methoxyethyl)-N-[(4-methyloxan-4-yl)methyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | P970-1894 |
| Compound Name: | 4-fluoro-N-(2-methoxyethyl)-N-[(4-methyloxan-4-yl)methyl]benzene-1-sulfonamide |
| Molecular Weight: | 345.43 |
| Molecular Formula: | C16 H24 F N O4 S |
| Smiles: | CC1(CCOCC1)CN(CCOC)S(c1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3717 |
| logD: | 2.3717 |
| logSw: | -2.5977 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 48.035 |
| InChI Key: | FQCMWQRNIPTYBU-UHFFFAOYSA-N |