3-chloro-4-fluoro-N-methyl-N-[(oxan-4-yl)methyl]benzene-1-sulfonamide
Chemical Structure Depiction of
3-chloro-4-fluoro-N-methyl-N-[(oxan-4-yl)methyl]benzene-1-sulfonamide
3-chloro-4-fluoro-N-methyl-N-[(oxan-4-yl)methyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | P970-2304 |
| Compound Name: | 3-chloro-4-fluoro-N-methyl-N-[(oxan-4-yl)methyl]benzene-1-sulfonamide |
| Molecular Weight: | 321.8 |
| Molecular Formula: | C13 H17 Cl F N O3 S |
| Smiles: | CN(CC1CCOCC1)S(c1ccc(c(c1)[Cl])F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7739 |
| logD: | 2.7739 |
| logSw: | -3.3378 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 40.903 |
| InChI Key: | ZMCIIICHLBENHI-UHFFFAOYSA-N |