N-(2,3-dimethylphenyl)-N'-[(oxan-4-yl)methyl]urea
Chemical Structure Depiction of
N-(2,3-dimethylphenyl)-N'-[(oxan-4-yl)methyl]urea
N-(2,3-dimethylphenyl)-N'-[(oxan-4-yl)methyl]urea
Compound characteristics
| Compound ID: | P970-2652 |
| Compound Name: | N-(2,3-dimethylphenyl)-N'-[(oxan-4-yl)methyl]urea |
| Molecular Weight: | 262.35 |
| Molecular Formula: | C15 H22 N2 O2 |
| Smiles: | Cc1cccc(c1C)NC(NCC1CCOCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.95 |
| logD: | 2.95 |
| logSw: | -3.0027 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 41.266 |
| InChI Key: | MDBSAQKAVRUQQY-UHFFFAOYSA-N |