(2-amino-5-bromophenyl)(4-chlorophenyl)methanol
Chemical Structure Depiction of
(2-amino-5-bromophenyl)(4-chlorophenyl)methanol
(2-amino-5-bromophenyl)(4-chlorophenyl)methanol
Compound characteristics
| Compound ID: | R011-0005 |
| Compound Name: | (2-amino-5-bromophenyl)(4-chlorophenyl)methanol |
| Molecular Weight: | 312.59 |
| Molecular Formula: | C13 H11 Br Cl N O |
| Smiles: | c1cc(ccc1C(c1cc(ccc1N)[Br])O)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5326 |
| logD: | 3.5326 |
| logSw: | -3.5946 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 35.748 |
| InChI Key: | XVNKLNAILNKVOF-ZDUSSCGKSA-N |