2-chloro-N-(2,4-dimethoxyphenyl)acetamide
Chemical Structure Depiction of
2-chloro-N-(2,4-dimethoxyphenyl)acetamide
2-chloro-N-(2,4-dimethoxyphenyl)acetamide
Compound characteristics
| Compound ID: | R052-1725 |
| Compound Name: | 2-chloro-N-(2,4-dimethoxyphenyl)acetamide |
| Molecular Weight: | 229.66 |
| Molecular Formula: | C10 H12 Cl N O3 |
| Smiles: | COc1ccc(c(c1)OC)NC(C[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 1.5793 |
| logD: | 1.5764 |
| logSw: | -2.1125 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.864 |
| InChI Key: | SPDLCISEBHCEFN-UHFFFAOYSA-N |