4-nitro-7-(piperidin-1-yl)-2,1,3-benzoxadiazol-5-amine
Chemical Structure Depiction of
4-nitro-7-(piperidin-1-yl)-2,1,3-benzoxadiazol-5-amine
4-nitro-7-(piperidin-1-yl)-2,1,3-benzoxadiazol-5-amine
Compound characteristics
| Compound ID: | R052-2063 |
| Compound Name: | 4-nitro-7-(piperidin-1-yl)-2,1,3-benzoxadiazol-5-amine |
| Molecular Weight: | 263.25 |
| Molecular Formula: | C11 H13 N5 O3 |
| Smiles: | C1CCN(CC1)c1cc(c(c2c1non2)[N+]([O-])=O)N |
| Stereo: | ACHIRAL |
| logP: | 2.6896 |
| logD: | 2.6896 |
| logSw: | -3.2751 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 93.126 |
| InChI Key: | OCPXBISWYZIOFW-UHFFFAOYSA-N |