5-(3-chlorophenyl)cyclohexane-1,3-dione
Chemical Structure Depiction of
5-(3-chlorophenyl)cyclohexane-1,3-dione
5-(3-chlorophenyl)cyclohexane-1,3-dione
Compound characteristics
| Compound ID: | R052-3840 |
| Compound Name: | 5-(3-chlorophenyl)cyclohexane-1,3-dione |
| Molecular Weight: | 222.67 |
| Molecular Formula: | C12 H11 Cl O2 |
| Smiles: | C1C(CC(CC1=O)=O)c1cccc(c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 2.3438 |
| logD: | -1.7166 |
| logSw: | -2.7977 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 26.8577 |
| InChI Key: | YSNSALYPQQBIDC-UHFFFAOYSA-N |