3-(morpholin-4-yl)-2-phenylprop-2-enenitrile
Chemical Structure Depiction of
3-(morpholin-4-yl)-2-phenylprop-2-enenitrile
3-(morpholin-4-yl)-2-phenylprop-2-enenitrile
Compound characteristics
| Compound ID: | R384-0020 |
| Compound Name: | 3-(morpholin-4-yl)-2-phenylprop-2-enenitrile |
| Molecular Weight: | 214.26 |
| Molecular Formula: | C13 H14 N2 O |
| Smiles: | C1COCCN1/C=C(C#N)\c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 1.3259 |
| logD: | 1.3259 |
| logSw: | -1.4935 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 29.546 |
| InChI Key: | RVDAXHHFWRWCAW-UHFFFAOYSA-N |