ethyl [10-(N,N-dimethylglycyl)-10H-phenothiazin-2-yl]carbamate--hydrogen chloride (1/1)
Chemical Structure Depiction of
ethyl [10-(N,N-dimethylglycyl)-10H-phenothiazin-2-yl]carbamate--hydrogen chloride (1/1)
ethyl [10-(N,N-dimethylglycyl)-10H-phenothiazin-2-yl]carbamate--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | S008-0095 |
| Compound Name: | ethyl [10-(N,N-dimethylglycyl)-10H-phenothiazin-2-yl]carbamate--hydrogen chloride (1/1) |
| Molecular Weight: | 407.92 |
| Molecular Formula: | C19 H21 N3 O3 S |
| Salt: | HCl |
| Smiles: | CCOC(Nc1ccc2c(c1)N(C(CN(C)C)=O)c1ccccc1S2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9782 |
| logD: | 2.9777 |
| logSw: | -3.4717 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.945 |
| InChI Key: | LGWVIIQGKLLMKO-UHFFFAOYSA-N |