[3'-(cyclopentylamino)-1'H-spiro[piperidine-3,2'-quinoxalin]-1-yl](thiophen-2-yl)methanone
Chemical Structure Depiction of
[3'-(cyclopentylamino)-1'H-spiro[piperidine-3,2'-quinoxalin]-1-yl](thiophen-2-yl)methanone
[3'-(cyclopentylamino)-1'H-spiro[piperidine-3,2'-quinoxalin]-1-yl](thiophen-2-yl)methanone
Compound characteristics
| Compound ID: | S019-0795 |
| Compound Name: | [3'-(cyclopentylamino)-1'H-spiro[piperidine-3,2'-quinoxalin]-1-yl](thiophen-2-yl)methanone |
| Molecular Weight: | 394.54 |
| Molecular Formula: | C22 H26 N4 O S |
| Smiles: | C1CCC(C1)NC1C2(CCCN(C2)C(c2cccs2)=O)Nc2ccccc2N=1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7419 |
| logD: | 3.7418 |
| logSw: | -3.9738 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.728 |
| InChI Key: | BMPMXQMDKICJCL-QFIPXVFZSA-N |