N-(2,4-dimethylphenyl)-2-(4-methoxyphenyl)-4-oxo-4,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7(1H)-carboxamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-2-(4-methoxyphenyl)-4-oxo-4,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7(1H)-carboxamide
N-(2,4-dimethylphenyl)-2-(4-methoxyphenyl)-4-oxo-4,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7(1H)-carboxamide
Compound characteristics
| Compound ID: | S020-2781 |
| Compound Name: | N-(2,4-dimethylphenyl)-2-(4-methoxyphenyl)-4-oxo-4,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7(1H)-carboxamide |
| Molecular Weight: | 404.47 |
| Molecular Formula: | C23 H24 N4 O3 |
| Smiles: | Cc1ccc(c(C)c1)NC(N1CCC2=C(C1)NC(c1ccc(cc1)OC)=NC2=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4608 |
| logD: | 1.9383 |
| logSw: | -3.5959 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.918 |
| InChI Key: | IFCOJIQEISGZHX-UHFFFAOYSA-N |