1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-2-(2-methylphenoxy)ethan-1-one
Chemical Structure Depiction of
1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-2-(2-methylphenoxy)ethan-1-one
1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-2-(2-methylphenoxy)ethan-1-one
Compound characteristics
| Compound ID: | S023-3634 |
| Compound Name: | 1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-2-(2-methylphenoxy)ethan-1-one |
| Molecular Weight: | 367.45 |
| Molecular Formula: | C20 H25 N5 O2 |
| Smiles: | CC1CN=C2C(=NC=CN12)N1CCN(CC1)C(COc1ccccc1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.1798 |
| logD: | 1.1039 |
| logSw: | -1.6563 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.135 |
| InChI Key: | QTUCNKZLXZMCSD-MRXNPFEDSA-N |