N-{rel-(1R,4R,6S)-2-[2-(trifluoromethyl)benzoyl]-2-azabicyclo[2.2.1]heptan-6-yl}pyridine-3-carboxamide
Chemical Structure Depiction of
N-{rel-(1R,4R,6S)-2-[2-(trifluoromethyl)benzoyl]-2-azabicyclo[2.2.1]heptan-6-yl}pyridine-3-carboxamide
N-{rel-(1R,4R,6S)-2-[2-(trifluoromethyl)benzoyl]-2-azabicyclo[2.2.1]heptan-6-yl}pyridine-3-carboxamide
Compound characteristics
| Compound ID: | S032-1357 |
| Compound Name: | N-{rel-(1R,4R,6S)-2-[2-(trifluoromethyl)benzoyl]-2-azabicyclo[2.2.1]heptan-6-yl}pyridine-3-carboxamide |
| Molecular Weight: | 389.38 |
| Molecular Formula: | C20 H18 F3 N3 O2 |
| Smiles: | C1[C@@H]([C@H]2C[C@@H]1CN2C(c1ccccc1C(F)(F)F)=O)NC(c1cccnc1)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 2.2651 |
| logD: | 2.2651 |
| logSw: | -2.4493 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.617 |
| InChI Key: | KZIWOTHQKKLPJK-VUCTXSBTSA-N |