(3-fluorophenyl){3-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl}methanone
Chemical Structure Depiction of
(3-fluorophenyl){3-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl}methanone
(3-fluorophenyl){3-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl}methanone
Compound characteristics
| Compound ID: | S050-0235 |
| Compound Name: | (3-fluorophenyl){3-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)phenoxy]azetidin-1-yl}methanone |
| Molecular Weight: | 415.42 |
| Molecular Formula: | C24 H18 F N3 O3 |
| Smiles: | C1C(CN1C(c1cccc(c1)F)=O)Oc1ccc(cc1)c1nc(c2ccccc2)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.5538 |
| logD: | 4.5538 |
| logSw: | -4.6139 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.752 |
| InChI Key: | AJKUCPNLQGKOAF-UHFFFAOYSA-N |