N-[(2-methoxypyridin-3-yl)methyl]-N-methyl-1H-indazole-3-carboxamide
Chemical Structure Depiction of
N-[(2-methoxypyridin-3-yl)methyl]-N-methyl-1H-indazole-3-carboxamide
N-[(2-methoxypyridin-3-yl)methyl]-N-methyl-1H-indazole-3-carboxamide
Compound characteristics
| Compound ID: | S055-1353 |
| Compound Name: | N-[(2-methoxypyridin-3-yl)methyl]-N-methyl-1H-indazole-3-carboxamide |
| Molecular Weight: | 296.33 |
| Molecular Formula: | C16 H16 N4 O2 |
| Smiles: | CN(Cc1cccnc1OC)C(c1c2ccccc2[nH]n1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3294 |
| logD: | 2.3294 |
| logSw: | -2.6794 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.985 |
| InChI Key: | LPPSDUQLGAGVPY-UHFFFAOYSA-N |