N-methyl-N-[(2-phenoxypyridin-3-yl)methyl]cyclopropanesulfonamide
					Chemical Structure Depiction of
N-methyl-N-[(2-phenoxypyridin-3-yl)methyl]cyclopropanesulfonamide
			N-methyl-N-[(2-phenoxypyridin-3-yl)methyl]cyclopropanesulfonamide
Compound characteristics
| Compound ID: | S055-1642 | 
| Compound Name: | N-methyl-N-[(2-phenoxypyridin-3-yl)methyl]cyclopropanesulfonamide | 
| Molecular Weight: | 318.39 | 
| Molecular Formula: | C16 H18 N2 O3 S | 
| Smiles: | CN(Cc1cccnc1Oc1ccccc1)S(C1CC1)(=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 3.0554 | 
| logD: | 3.0554 | 
| logSw: | -3.2738 | 
| Hydrogen bond acceptors count: | 7 | 
| Polar surface area: | 49.879 | 
| InChI Key: | QGWYKCWGFZOMLU-UHFFFAOYSA-N | 
 
				 
				