{4-[(6-ethoxypyridin-3-yl)methyl]piperazin-1-yl}(1-methyl-1H-pyrrol-2-yl)methanone
Chemical Structure Depiction of
{4-[(6-ethoxypyridin-3-yl)methyl]piperazin-1-yl}(1-methyl-1H-pyrrol-2-yl)methanone
{4-[(6-ethoxypyridin-3-yl)methyl]piperazin-1-yl}(1-methyl-1H-pyrrol-2-yl)methanone
Compound characteristics
| Compound ID: | S056-0229 |
| Compound Name: | {4-[(6-ethoxypyridin-3-yl)methyl]piperazin-1-yl}(1-methyl-1H-pyrrol-2-yl)methanone |
| Molecular Weight: | 328.41 |
| Molecular Formula: | C18 H24 N4 O2 |
| Smiles: | CCOc1ccc(CN2CCN(CC2)C(c2cccn2C)=O)cn1 |
| Stereo: | ACHIRAL |
| logP: | 2.2713 |
| logD: | 2.2694 |
| logSw: | -2.244 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.006 |
| InChI Key: | GKFVIZYUTKEJLD-UHFFFAOYSA-N |