N'-(4-bromophenyl)-N-[(oxolan-3-yl)methyl]-N-propylurea
Chemical Structure Depiction of
N'-(4-bromophenyl)-N-[(oxolan-3-yl)methyl]-N-propylurea
N'-(4-bromophenyl)-N-[(oxolan-3-yl)methyl]-N-propylurea
Compound characteristics
| Compound ID: | S213-1317 |
| Compound Name: | N'-(4-bromophenyl)-N-[(oxolan-3-yl)methyl]-N-propylurea |
| Molecular Weight: | 341.25 |
| Molecular Formula: | C15 H21 Br N2 O2 |
| Smiles: | CCCN(CC1CCOC1)C(Nc1ccc(cc1)[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7365 |
| logD: | 3.7365 |
| logSw: | -3.9114 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.213 |
| InChI Key: | PUUZJSAXASSKJC-GFCCVEGCSA-N |