4-ethyl-N-methyl-N-[(oxolan-3-yl)methyl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-ethyl-N-methyl-N-[(oxolan-3-yl)methyl]benzene-1-sulfonamide
4-ethyl-N-methyl-N-[(oxolan-3-yl)methyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | S213-1634 |
| Compound Name: | 4-ethyl-N-methyl-N-[(oxolan-3-yl)methyl]benzene-1-sulfonamide |
| Molecular Weight: | 283.39 |
| Molecular Formula: | C14 H21 N O3 S |
| Smiles: | CCc1ccc(cc1)S(N(C)CC1CCOC1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.801 |
| logD: | 2.801 |
| logSw: | -3.1464 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 41.767 |
| InChI Key: | UPNQMWOBSRWTMV-CYBMUJFWSA-N |