rel-(3R,4S)-3-(dimethylamino)-4-phenyl-1-[(1H-pyrrol-2-yl)methyl]piperidin-4-ol
Chemical Structure Depiction of
rel-(3R,4S)-3-(dimethylamino)-4-phenyl-1-[(1H-pyrrol-2-yl)methyl]piperidin-4-ol
rel-(3R,4S)-3-(dimethylamino)-4-phenyl-1-[(1H-pyrrol-2-yl)methyl]piperidin-4-ol
Compound characteristics
| Compound ID: | S214-1373 |
| Compound Name: | rel-(3R,4S)-3-(dimethylamino)-4-phenyl-1-[(1H-pyrrol-2-yl)methyl]piperidin-4-ol |
| Molecular Weight: | 299.41 |
| Molecular Formula: | C18 H25 N3 O |
| Smiles: | CN(C)[C@@H]1CN(CC[C@@]1(c1ccccc1)O)Cc1ccc[nH]1 |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 1.7802 |
| logD: | 1.4709 |
| logSw: | -1.5177 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 31.1046 |
| InChI Key: | PPWNGSOGFSGGOH-ZWKOTPCHSA-N |