N-(5-chloro-2,4-dimethoxyphenyl)-2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2,3-dihydro-1H-indole-1-carboxamide
Chemical Structure Depiction of
N-(5-chloro-2,4-dimethoxyphenyl)-2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2,3-dihydro-1H-indole-1-carboxamide
N-(5-chloro-2,4-dimethoxyphenyl)-2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2,3-dihydro-1H-indole-1-carboxamide
Compound characteristics
| Compound ID: | S219-0701 |
| Compound Name: | N-(5-chloro-2,4-dimethoxyphenyl)-2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2,3-dihydro-1H-indole-1-carboxamide |
| Molecular Weight: | 440.89 |
| Molecular Formula: | C22 H21 Cl N4 O4 |
| Smiles: | COc1cc(c(cc1NC(N1C(Cc2ccccc12)c1nc(C2CC2)no1)=O)[Cl])OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3719 |
| logD: | 5.3704 |
| logSw: | -5.9293 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.578 |
| InChI Key: | OIXVMBXKDWWHOY-KRWDZBQOSA-N |