4-{4-[(dimethylamino)methyl]-8-oxa-2-azaspiro[4.5]decane-2-carbonyl}benzonitrile
Chemical Structure Depiction of
4-{4-[(dimethylamino)methyl]-8-oxa-2-azaspiro[4.5]decane-2-carbonyl}benzonitrile
4-{4-[(dimethylamino)methyl]-8-oxa-2-azaspiro[4.5]decane-2-carbonyl}benzonitrile
Compound characteristics
| Compound ID: | S223-0083 |
| Compound Name: | 4-{4-[(dimethylamino)methyl]-8-oxa-2-azaspiro[4.5]decane-2-carbonyl}benzonitrile |
| Molecular Weight: | 327.42 |
| Molecular Formula: | C19 H25 N3 O2 |
| Smiles: | CN(C)CC1CN(CC12CCOCC2)C(c1ccc(C#N)cc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.1248 |
| logD: | -1.0905 |
| logSw: | -1.9184 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.892 |
| InChI Key: | GRRNUCQITQDCPA-QGZVFWFLSA-N |