2-(2-chloro-6-fluorophenyl)-1-[4-(methoxymethyl)-8-oxa-2-azaspiro[4.5]decan-2-yl]ethan-1-one
Chemical Structure Depiction of
2-(2-chloro-6-fluorophenyl)-1-[4-(methoxymethyl)-8-oxa-2-azaspiro[4.5]decan-2-yl]ethan-1-one
2-(2-chloro-6-fluorophenyl)-1-[4-(methoxymethyl)-8-oxa-2-azaspiro[4.5]decan-2-yl]ethan-1-one
Compound characteristics
| Compound ID: | S247-0072 |
| Compound Name: | 2-(2-chloro-6-fluorophenyl)-1-[4-(methoxymethyl)-8-oxa-2-azaspiro[4.5]decan-2-yl]ethan-1-one |
| Molecular Weight: | 355.84 |
| Molecular Formula: | C18 H23 Cl F N O3 |
| Smiles: | COCC1CN(CC12CCOCC2)C(Cc1c(cccc1[Cl])F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.7218 |
| logD: | 2.7218 |
| logSw: | -3.2979 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.845 |
| InChI Key: | OCFKWBVMUWTPAZ-ZDUSSCGKSA-N |