3-(4-methoxyphenyl)-1-{rel-(1R,5S)-3-[3-(pyridin-4-yl)-1,2,4-oxadiazol-5-yl]-8-azabicyclo[3.2.1]octan-8-yl}propan-1-one
Chemical Structure Depiction of
3-(4-methoxyphenyl)-1-{rel-(1R,5S)-3-[3-(pyridin-4-yl)-1,2,4-oxadiazol-5-yl]-8-azabicyclo[3.2.1]octan-8-yl}propan-1-one
3-(4-methoxyphenyl)-1-{rel-(1R,5S)-3-[3-(pyridin-4-yl)-1,2,4-oxadiazol-5-yl]-8-azabicyclo[3.2.1]octan-8-yl}propan-1-one
Compound characteristics
| Compound ID: | S253-0749 |
| Compound Name: | 3-(4-methoxyphenyl)-1-{rel-(1R,5S)-3-[3-(pyridin-4-yl)-1,2,4-oxadiazol-5-yl]-8-azabicyclo[3.2.1]octan-8-yl}propan-1-one |
| Molecular Weight: | 418.49 |
| Molecular Formula: | C24 H26 N4 O3 |
| Smiles: | COc1ccc(CCC(N2[C@H]3CC[C@@H]2C[C@H](C3)c2nc(c3ccncc3)no2)=O)cc1 |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 3.4432 |
| logD: | 3.4431 |
| logSw: | -3.2386 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 63.609 |
| InChI Key: | RQQRRZMKQGMKGO-ACDBMABISA-N |