(2S,4S)-N-(3-ethylphenyl)-4-fluoro-2-(morpholine-4-carbonyl)pyrrolidine-1-carboxamide
Chemical Structure Depiction of
(2S,4S)-N-(3-ethylphenyl)-4-fluoro-2-(morpholine-4-carbonyl)pyrrolidine-1-carboxamide
(2S,4S)-N-(3-ethylphenyl)-4-fluoro-2-(morpholine-4-carbonyl)pyrrolidine-1-carboxamide
Compound characteristics
| Compound ID: | S254-0418 |
| Compound Name: | (2S,4S)-N-(3-ethylphenyl)-4-fluoro-2-(morpholine-4-carbonyl)pyrrolidine-1-carboxamide |
| Molecular Weight: | 349.4 |
| Molecular Formula: | C18 H24 F N3 O3 |
| Smiles: | CCc1cccc(c1)NC(N1C[C@H](C[C@H]1C(N1CCOCC1)=O)F)=O |
| Stereo: | ABSOLUTE |
| logP: | 1.8734 |
| logD: | 1.8734 |
| logSw: | -2.412 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.258 |
| InChI Key: | SBFJFGQKPLBALR-GOEBONIOSA-N |