N-{1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl}-2-methoxybenzamide
Chemical Structure Depiction of
N-{1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl}-2-methoxybenzamide
N-{1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl}-2-methoxybenzamide
Compound characteristics
| Compound ID: | S259-4173 |
| Compound Name: | N-{1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl}-2-methoxybenzamide |
| Molecular Weight: | 343.42 |
| Molecular Formula: | C19 H25 N3 O3 |
| Smiles: | Cc1c(CN2CCC(CC2)NC(c2ccccc2OC)=O)c(C)on1 |
| Stereo: | ACHIRAL |
| logP: | 2.1814 |
| logD: | -0.8194 |
| logSw: | -2.821 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.586 |
| InChI Key: | PPNUZQLEYWKMCU-UHFFFAOYSA-N |