N-{1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl}-2-(3-methylphenyl)acetamide
Chemical Structure Depiction of
N-{1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl}-2-(3-methylphenyl)acetamide
N-{1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl}-2-(3-methylphenyl)acetamide
Compound characteristics
| Compound ID: | S259-4201 |
| Compound Name: | N-{1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]piperidin-4-yl}-2-(3-methylphenyl)acetamide |
| Molecular Weight: | 341.45 |
| Molecular Formula: | C20 H27 N3 O2 |
| Smiles: | Cc1cccc(CC(NC2CCN(CC2)Cc2c(C)noc2C)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 2.5844 |
| logD: | -0.5325 |
| logSw: | -2.6484 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.742 |
| InChI Key: | OOWNWNJBFLRHNT-UHFFFAOYSA-N |