4-(3-methoxyphenyl)-2-(thiomorpholin-4-yl)pyrimidine-5-carboxylic acid
Chemical Structure Depiction of
4-(3-methoxyphenyl)-2-(thiomorpholin-4-yl)pyrimidine-5-carboxylic acid
4-(3-methoxyphenyl)-2-(thiomorpholin-4-yl)pyrimidine-5-carboxylic acid
Compound characteristics
| Compound ID: | S272-0624 |
| Compound Name: | 4-(3-methoxyphenyl)-2-(thiomorpholin-4-yl)pyrimidine-5-carboxylic acid |
| Molecular Weight: | 331.39 |
| Molecular Formula: | C16 H17 N3 O3 S |
| Smiles: | COc1cccc(c1)c1c(cnc(n1)N1CCSCC1)C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6732 |
| logD: | 1.4961 |
| logSw: | -2.7785 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.161 |
| InChI Key: | WOJHYGVVBWYUMU-UHFFFAOYSA-N |