2-(2-methoxyethyl)-5-(3-methylbutyl)tetrahydropyrrolo[3,4-c]pyrrole-1,3(2H,3aH)-dione
Chemical Structure Depiction of
2-(2-methoxyethyl)-5-(3-methylbutyl)tetrahydropyrrolo[3,4-c]pyrrole-1,3(2H,3aH)-dione
2-(2-methoxyethyl)-5-(3-methylbutyl)tetrahydropyrrolo[3,4-c]pyrrole-1,3(2H,3aH)-dione
Compound characteristics
| Compound ID: | S296-1605 |
| Compound Name: | 2-(2-methoxyethyl)-5-(3-methylbutyl)tetrahydropyrrolo[3,4-c]pyrrole-1,3(2H,3aH)-dione |
| Molecular Weight: | 268.35 |
| Molecular Formula: | C14 H24 N2 O3 |
| Smiles: | CC(C)CCN1C[C@H]2C(N(CCOC)C([C@H]2C1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.5952 |
| logD: | -1.8043 |
| logSw: | -1.084 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 42.299 |
| InChI Key: | NHUFDPAWWJXGHS-RYUDHWBXSA-N |