rel-(1R,5S)-N-[(4-methoxyphenyl)methyl]-7-methyl-9-oxa-3,7-diazabicyclo[3.3.1]nonane-3-carboxamide
Chemical Structure Depiction of
rel-(1R,5S)-N-[(4-methoxyphenyl)methyl]-7-methyl-9-oxa-3,7-diazabicyclo[3.3.1]nonane-3-carboxamide
rel-(1R,5S)-N-[(4-methoxyphenyl)methyl]-7-methyl-9-oxa-3,7-diazabicyclo[3.3.1]nonane-3-carboxamide
Compound characteristics
| Compound ID: | S301-0642 |
| Compound Name: | rel-(1R,5S)-N-[(4-methoxyphenyl)methyl]-7-methyl-9-oxa-3,7-diazabicyclo[3.3.1]nonane-3-carboxamide |
| Molecular Weight: | 305.38 |
| Molecular Formula: | C16 H23 N3 O3 |
| Smiles: | CN1C[C@H]2CN(C[C@@H](C1)O2)C(NCc1ccc(cc1)OC)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 0.5462 |
| logD: | 0.2415 |
| logSw: | -1.7018 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.252 |
| InChI Key: | LTWRNEBSRAYLQJ-GJZGRUSLSA-N |