1-(benzenesulfonyl)-3-(4-ethyl-5-{[(3-fluorophenyl)methyl]sulfanyl}-4H-1,2,4-triazol-3-yl)-1H-indole
Chemical Structure Depiction of
1-(benzenesulfonyl)-3-(4-ethyl-5-{[(3-fluorophenyl)methyl]sulfanyl}-4H-1,2,4-triazol-3-yl)-1H-indole
1-(benzenesulfonyl)-3-(4-ethyl-5-{[(3-fluorophenyl)methyl]sulfanyl}-4H-1,2,4-triazol-3-yl)-1H-indole
Compound characteristics
| Compound ID: | S322-0143 |
| Compound Name: | 1-(benzenesulfonyl)-3-(4-ethyl-5-{[(3-fluorophenyl)methyl]sulfanyl}-4H-1,2,4-triazol-3-yl)-1H-indole |
| Molecular Weight: | 492.59 |
| Molecular Formula: | C25 H21 F N4 O2 S2 |
| Smiles: | CCn1c(c2cn(c3ccccc23)S(c2ccccc2)(=O)=O)nnc1SCc1cccc(c1)F |
| Stereo: | ACHIRAL |
| logP: | 5.3887 |
| logD: | 5.3887 |
| logSw: | -5.6619 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 52.958 |
| InChI Key: | HYAMVNICODSXQA-UHFFFAOYSA-N |