1-(benzenesulfonyl)-3-[5-{[(3,4-dichlorophenyl)methyl]sulfanyl}-4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl]-1H-indole
Chemical Structure Depiction of
1-(benzenesulfonyl)-3-[5-{[(3,4-dichlorophenyl)methyl]sulfanyl}-4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl]-1H-indole
1-(benzenesulfonyl)-3-[5-{[(3,4-dichlorophenyl)methyl]sulfanyl}-4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl]-1H-indole
Compound characteristics
| Compound ID: | S322-0267 |
| Compound Name: | 1-(benzenesulfonyl)-3-[5-{[(3,4-dichlorophenyl)methyl]sulfanyl}-4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl]-1H-indole |
| Molecular Weight: | 573.52 |
| Molecular Formula: | C26 H22 Cl2 N4 O3 S2 |
| Smiles: | COCCn1c(c2cn(c3ccccc23)S(c2ccccc2)(=O)=O)nnc1SCc1ccc(c(c1)[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.1569 |
| logD: | 6.1569 |
| logSw: | -6.1947 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 61.555 |
| InChI Key: | DFBJUDWTUBIZLO-UHFFFAOYSA-N |