N-{1-[(2-chlorophenyl)acetyl]piperidin-4-yl}-2-methoxy-N-(oxan-4-yl)acetamide
Chemical Structure Depiction of
N-{1-[(2-chlorophenyl)acetyl]piperidin-4-yl}-2-methoxy-N-(oxan-4-yl)acetamide
N-{1-[(2-chlorophenyl)acetyl]piperidin-4-yl}-2-methoxy-N-(oxan-4-yl)acetamide
Compound characteristics
| Compound ID: | S329-1873 |
| Compound Name: | N-{1-[(2-chlorophenyl)acetyl]piperidin-4-yl}-2-methoxy-N-(oxan-4-yl)acetamide |
| Molecular Weight: | 408.92 |
| Molecular Formula: | C21 H29 Cl N2 O4 |
| Smiles: | COCC(N(C1CCN(CC1)C(Cc1ccccc1[Cl])=O)C1CCOCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2899 |
| logD: | 2.2899 |
| logSw: | -2.7266 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.781 |
| InChI Key: | NJPOVOVMZWFISQ-UHFFFAOYSA-N |