N-(3,4-dimethylphenyl)-4-[(oxan-4-yl)(phenylacetyl)amino]piperidine-1-carboxamide
Chemical Structure Depiction of
N-(3,4-dimethylphenyl)-4-[(oxan-4-yl)(phenylacetyl)amino]piperidine-1-carboxamide
N-(3,4-dimethylphenyl)-4-[(oxan-4-yl)(phenylacetyl)amino]piperidine-1-carboxamide
Compound characteristics
| Compound ID: | S329-4888 |
| Compound Name: | N-(3,4-dimethylphenyl)-4-[(oxan-4-yl)(phenylacetyl)amino]piperidine-1-carboxamide |
| Molecular Weight: | 449.59 |
| Molecular Formula: | C27 H35 N3 O3 |
| Smiles: | Cc1ccc(cc1C)NC(N1CCC(CC1)N(C1CCOCC1)C(Cc1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5883 |
| logD: | 4.5883 |
| logSw: | -4.3849 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.433 |
| InChI Key: | ANXROVQQWRSOOB-UHFFFAOYSA-N |