N-(3,5-dimethoxyphenyl)-2-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)-1H-pyrrol-1-yl]acetamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-2-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)-1H-pyrrol-1-yl]acetamide
N-(3,5-dimethoxyphenyl)-2-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)-1H-pyrrol-1-yl]acetamide
Compound characteristics
| Compound ID: | S333-0319 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-2-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)-1H-pyrrol-1-yl]acetamide |
| Molecular Weight: | 404.42 |
| Molecular Formula: | C22 H20 N4 O4 |
| Smiles: | COc1cc(cc(c1)OC)NC(Cn1cccc1c1nc(c2ccccc2)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7187 |
| logD: | 4.7183 |
| logSw: | -4.4351 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.47 |
| InChI Key: | HLPJFRMFZXVOGF-UHFFFAOYSA-N |