2-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)-1H-pyrrol-1-yl]-N-(3-phenylpropyl)acetamide
Chemical Structure Depiction of
2-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)-1H-pyrrol-1-yl]-N-(3-phenylpropyl)acetamide
2-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)-1H-pyrrol-1-yl]-N-(3-phenylpropyl)acetamide
Compound characteristics
| Compound ID: | S333-0334 |
| Compound Name: | 2-[2-(3-phenyl-1,2,4-oxadiazol-5-yl)-1H-pyrrol-1-yl]-N-(3-phenylpropyl)acetamide |
| Molecular Weight: | 386.45 |
| Molecular Formula: | C23 H22 N4 O2 |
| Smiles: | C(Cc1ccccc1)CNC(Cn1cccc1c1nc(c2ccccc2)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9086 |
| logD: | 4.9086 |
| logSw: | -4.8446 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.547 |
| InChI Key: | KLCYQCWOMDMOHN-UHFFFAOYSA-N |