2-(4-methoxyphenyl)-7-{[(thiophen-2-yl)methyl]amino}-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one
Chemical Structure Depiction of
2-(4-methoxyphenyl)-7-{[(thiophen-2-yl)methyl]amino}-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one
2-(4-methoxyphenyl)-7-{[(thiophen-2-yl)methyl]amino}-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one
Compound characteristics
| Compound ID: | S335-0318 |
| Compound Name: | 2-(4-methoxyphenyl)-7-{[(thiophen-2-yl)methyl]amino}-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one |
| Molecular Weight: | 354.43 |
| Molecular Formula: | C18 H18 N4 O2 S |
| Smiles: | COc1ccc(cc1)c1cc2C(NCC(NCc3cccs3)n2n1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.2878 |
| logD: | 2.285 |
| logSw: | -2.8243 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.499 |
| InChI Key: | WZTSUDCCBLPIRP-KRWDZBQOSA-N |